cas: 153982-44-6 — see every product listed under this CAS number, including other names
5H-Imidazo[4,5-c]pyridine-5,6-dicarboxylic acid, 1,4,6,7-tetrahydro-, 5-(1,1-dimethylethyl) ester, (S)-, 95%, 95% (CAS 153982-44-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AQJW-250mg |
| cas | 153982-44-6 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 578.00 Pln | |
| Chemat | 1g | 1374.80 Pln | |
| Chemat | 5g | 3957.20 Pln | |
| Chemat | 100mg | 371.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(6S)-5-[(2-methylpropan-2-yl)oxycarbonyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-6-carboxylic acid (CAS 153982-44-6) is a chemical compound with the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. IUPAC name: (6S)-5-[(2-methylpropan-2-yl)oxycarbonyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-6-carboxylic acid. InChIKey: YGCXTGCCLCADLQ-VIFPVBQESA-N.
| Molecular formula | C12H17N3O4 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | (6S)-5-[(2-methylpropan-2-yl)oxycarbonyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-6-carboxylic acid |
| InChIKey | YGCXTGCCLCADLQ-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C[C@H]1C(=O)O)N=CN2 |
Computed by PubChem (NCBI)