cas: 153982-44-6 — see every product listed under this CAS number, including other names
(S)-5-(TERT-BUTOXYCARBONYL)-4,5,6,7-TETRAHYDRO-3H-IMIDAZO[4,5-C]PYRIDINE-6-CARBOXYLIC ACID, 95% (CAS 153982-44-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F304579-1G |
| cas | 153982-44-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 981.96 Pln | |
| Fluorochem | 5g | 3501.91 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(6S)-5-[(2-methylpropan-2-yl)oxycarbonyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-6-carboxylic acid (CAS 153982-44-6) is a chemical compound with the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. IUPAC name: (6S)-5-[(2-methylpropan-2-yl)oxycarbonyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-6-carboxylic acid. InChIKey: YGCXTGCCLCADLQ-VIFPVBQESA-N.
| Molecular formula | C12H17N3O4 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | (6S)-5-[(2-methylpropan-2-yl)oxycarbonyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-6-carboxylic acid |
| InChIKey | YGCXTGCCLCADLQ-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C[C@H]1C(=O)O)N=CN2 |
Computed by PubChem (NCBI)