CAS 104047-06-5 is the registry number for 5H-Perfluoro-3,4-bis(trifluoromethyl)hexa-2,4-diene, cis/trans mix, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2E,4Z)-1,1,1,2,6,6,6-heptafluoro-3,4-bis(trifluoromethyl)hexa-2,4-diene (CAS 104047-06-5) is a chemical compound with the molecular formula C8HF13 and a molecular weight of 344.07 g/mol. IUPAC name: (2E,4Z)-1,1,1,2,6,6,6-heptafluoro-3,4-bis(trifluoromethyl)hexa-2,4-diene. InChIKey: DPXNAJTXBVCZPB-BXTBVDPRSA-N.
| Molecular formula | C8HF13 |
|---|---|
| Molecular weight | 344.07 g/mol |
| IUPAC name | (2E,4Z)-1,1,1,2,6,6,6-heptafluoro-3,4-bis(trifluoromethyl)hexa-2,4-diene |
| InChIKey | DPXNAJTXBVCZPB-BXTBVDPRSA-N |
| SMILES | C(=C(/C(=C(/C(F)(F)F)\F)/C(F)(F)F)\C(F)(F)F)\C(F)(F)F |
Computed by PubChem (NCBI)