cas: 73075-49-7 — see every product listed under this CAS number, including other names
6,7-Dichloro-1,2,3,4-tetrahydroisoquinoline hydrochloride 97% (CAS 73075-49-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A209919-250mg |
| cas | 73075-49-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 476.06 Pln | |
| Ambeed | 1g | 1043.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A209919 |
6,7-dichloro-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 73075-49-7) is a chemical compound with the molecular formula C9H10Cl3N and a molecular weight of 238.5 g/mol. IUPAC name: 6,7-dichloro-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: BSRXWAYVSPJBFZ-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl3N |
|---|---|
| Molecular weight | 238.5 g/mol |
| IUPAC name | 6,7-dichloro-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | BSRXWAYVSPJBFZ-UHFFFAOYSA-N |
| SMILES | C1CNCC2=CC(=C(C=C21)Cl)Cl.Cl |
Computed by PubChem (NCBI)