CAS 73075-49-7 appears in our catalog under these names: 6,7-Dichloro-1,2,3,4-tetrahydroisoquinoline hydrochloride, 97%, 6,7-Dichloro-1,2,3,4-tetrahydro-isoquinoline Hydrochloride, 6,7–Dichloro–1,2,3,4–tetrahydroisoquinoline hydrochloride, 6,7-Dichloro-1,2,3,4-tetrahydroisoquinoline hydrochloride, 6,7-Dichloro-1,2,3,4-Tetrahydroisoquinoline Hydrochloride, 98%, 98%. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 2,5g, 25mg, 0,5g, 5g, 50mg.
6,7-dichloro-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 73075-49-7) is a chemical compound with the molecular formula C9H10Cl3N and a molecular weight of 238.5 g/mol. IUPAC name: 6,7-dichloro-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: BSRXWAYVSPJBFZ-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl3N |
|---|---|
| Molecular weight | 238.5 g/mol |
| IUPAC name | 6,7-dichloro-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | BSRXWAYVSPJBFZ-UHFFFAOYSA-N |
| SMILES | C1CNCC2=CC(=C(C=C21)Cl)Cl.Cl |
Computed by PubChem (NCBI)