CAS 1215415-04-5 appears in our catalog under these names: 1-(2,4-Dichlorophenyl)cyclopropanamine hydrochloride, 95%, 1-(2,4-Dichlorophenyl)cyclopropanamine hydrochloride 96%, 1-(2,4-Dichlorophenyl)cyclopropanamine hydrochloride, 96%, 96%, 1-(2,4-DICHLOROPHENYL)CYCLOPROPANAMINE HCL, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 1g, 5g, 100mg.
1-(2,4-dichlorophenyl)cyclopropan-1-amine;hydrochloride (CAS 1215415-04-5) is a chemical compound with the molecular formula C9H10Cl3N and a molecular weight of 238.5 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: DENBZVWTMBOJOP-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl3N |
|---|---|
| Molecular weight | 238.5 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | DENBZVWTMBOJOP-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=C(C=C(C=C2)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)