cas: 69300-50-1 — see every product listed under this CAS number, including other names
6,7-Dihydro-5H-spiro(benzo(b)thiophene-4,4'-imidazolidine)-2',5'-dione, 97% (CAS 69300-50-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A340452-5g |
| cas | 69300-50-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 11495.05 Pln | |
| AmBeed | 10g | 17842.30 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione (CAS 69300-50-1) is a chemical compound with the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. IUPAC name: spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione. InChIKey: CWFRYKWJIHQOFY-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2S |
|---|---|
| Molecular weight | 222.27 g/mol |
| IUPAC name | spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione |
| InChIKey | CWFRYKWJIHQOFY-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CS2)C3(C1)C(=O)NC(=O)N3 |
Computed by PubChem (NCBI)