cas: 4118-36-9 — see every product listed under this CAS number, including other names
6,7-Dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline, 97%, 97% (CAS 4118-36-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C9CR-100mg |
| cas | 4118-36-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 1240.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6,7-dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline (CAS 4118-36-9) is a chemical compound with the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. IUPAC name: 6,7-dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline. InChIKey: GZGZWZVAJDFXJK-UHFFFAOYSA-N.
| Molecular formula | C17H19NO2 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 6,7-dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline |
| InChIKey | GZGZWZVAJDFXJK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(NCCC2=C1)C3=CC=CC=C3)OC |
Computed by PubChem (NCBI)