cas: 18711-12-1 — see every product listed under this CAS number, including other names
6,7-dichloro-1H-indole-2,3-dione (CAS 18711-12-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F313017-1G |
| cas | 18711-12-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3106.22 Pln | |
| Fluorochem | 5g | 10473.41 Pln | |
| Fluorochem | 250mg | 862.21 Pln |
| delivery time | 3-4 weeks |
|---|
6,7-dichloro-1H-indole-2,3-dione (CAS 18711-12-1) is a chemical compound with the molecular formula C8H3Cl2NO2 and a molecular weight of 216.02 g/mol. IUPAC name: 6,7-dichloro-1H-indole-2,3-dione. InChIKey: XTXIILHWOQZVAQ-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2NO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | 6,7-dichloro-1H-indole-2,3-dione |
| InChIKey | XTXIILHWOQZVAQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=O)C(=O)N2)Cl)Cl |
Computed by PubChem (NCBI)