cas: 858516-69-5 — see every product listed under this CAS number, including other names
6,8-Dichloroimidazo[1,2-a]pyridine, 98% (CAS 858516-69-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F441608-5G |
| cas | 858516-69-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 206.20 Pln | |
| Fluorochem | 10g | 310.33 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6,8-dichloroimidazo[1,2-a]pyridine (CAS 858516-69-5) is a chemical compound with the molecular formula C7H4Cl2N2 and a molecular weight of 187.02 g/mol. IUPAC name: 6,8-dichloroimidazo[1,2-a]pyridine. InChIKey: ZAHCPJDXWPIZSL-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2 |
|---|---|
| Molecular weight | 187.02 g/mol |
| IUPAC name | 6,8-dichloroimidazo[1,2-a]pyridine |
| InChIKey | ZAHCPJDXWPIZSL-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(C=C(C2=N1)Cl)Cl |
Computed by PubChem (NCBI)