cas: 885950-11-8 — see every product listed under this CAS number, including other names
6–(4–Formylphenyl)nicotinaldehyde (CAS 885950-11-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 25mg, 500mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD13856-100mg |
| cas | 885950-11-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 1280.39 Pln | |
| GLPBio | 1g | 4678.44 Pln | |
| GLPBio | 25mg | 774.90 Pln | |
| GLPBio | 500mg | 3091.75 Pln | |
| GLPBio | 5g | 10632.03 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
6-(4-formylphenyl)pyridine-3-carbaldehyde (CAS 885950-11-8) is a chemical compound with the molecular formula C13H9NO2 and a molecular weight of 211.22 g/mol. IUPAC name: 6-(4-formylphenyl)pyridine-3-carbaldehyde. InChIKey: ZVFZQBYTHFYAJE-UHFFFAOYSA-N.
| Molecular formula | C13H9NO2 |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 6-(4-formylphenyl)pyridine-3-carbaldehyde |
| InChIKey | ZVFZQBYTHFYAJE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=NC=C(C=C2)C=O |
Computed by PubChem (NCBI)