cas: 1609960-30-6 — see every product listed under this CAS number, including other names
6-(2,3-Dichlorophenyl)-4-N-methylpyrimidine-2,4-diamine, 99%, 99% (CAS 1609960-30-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ABP6-50mg |
| cas | 1609960-30-6 |
| size | 50mg |
| availability | 0.15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 698.00 Pln | |
| Chemat | 25mg | 434.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
6-(2,3-dichlorophenyl)-4-N-methylpyrimidine-2,4-diamine (CAS 1609960-30-6) is a chemical compound with the molecular formula C11H10Cl2N4 and a molecular weight of 269.13 g/mol. IUPAC name: 6-(2,3-dichlorophenyl)-4-N-methylpyrimidine-2,4-diamine. InChIKey: URWCXPXBBITYLR-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2N4 |
|---|---|
| Molecular weight | 269.13 g/mol |
| IUPAC name | 6-(2,3-dichlorophenyl)-4-N-methylpyrimidine-2,4-diamine |
| InChIKey | URWCXPXBBITYLR-UHFFFAOYSA-N |
| SMILES | CNC1=NC(=NC(=C1)C2=C(C(=CC=C2)Cl)Cl)N |
Computed by PubChem (NCBI)