cas: 1609960-30-6 — see every product listed under this CAS number, including other names
TH287 (CAS 1609960-30-6) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 5mg, 10mM (in 1ml dmso). Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC17601-10 |
| cas | 1609960-30-6 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 732.77 Pln | |
| GLPBio | 100mg | 1949.70 Pln | |
| GLPBio | 5mg | 643.84 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 629.80 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
6-(2,3-dichlorophenyl)-4-N-methylpyrimidine-2,4-diamine (CAS 1609960-30-6) is a chemical compound with the molecular formula C11H10Cl2N4 and a molecular weight of 269.13 g/mol. IUPAC name: 6-(2,3-dichlorophenyl)-4-N-methylpyrimidine-2,4-diamine. InChIKey: URWCXPXBBITYLR-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2N4 |
|---|---|
| Molecular weight | 269.13 g/mol |
| IUPAC name | 6-(2,3-dichlorophenyl)-4-N-methylpyrimidine-2,4-diamine |
| InChIKey | URWCXPXBBITYLR-UHFFFAOYSA-N |
| SMILES | CNC1=NC(=NC(=C1)C2=C(C(=CC=C2)Cl)Cl)N |
Computed by PubChem (NCBI)