CAS 1609960-30-6 appears in our catalog under these names: 6-(2,3-Dichlorophenyl)-4-N-methylpyrimidine-2,4-diamine, 95%, TH287/ 97.73% (existing batch purity), TH287, TH287 99%, 6-(2,3-Dichlorophenyl)-4-N-methylpyrimidine-2,4-diamine, 99%, 99%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 500mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg.
6-(2,3-dichlorophenyl)-4-N-methylpyrimidine-2,4-diamine (CAS 1609960-30-6) is a chemical compound with the molecular formula C11H10Cl2N4 and a molecular weight of 269.13 g/mol. IUPAC name: 6-(2,3-dichlorophenyl)-4-N-methylpyrimidine-2,4-diamine. InChIKey: URWCXPXBBITYLR-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2N4 |
|---|---|
| Molecular weight | 269.13 g/mol |
| IUPAC name | 6-(2,3-dichlorophenyl)-4-N-methylpyrimidine-2,4-diamine |
| InChIKey | URWCXPXBBITYLR-UHFFFAOYSA-N |
| SMILES | CNC1=NC(=NC(=C1)C2=C(C(=CC=C2)Cl)Cl)N |
Computed by PubChem (NCBI)