cas: 898561-66-5 — see every product listed under this CAS number, including other names
6-(2,2-Dimethyl-propionylamino)-nicotinic acid, 95%, 95% (CAS 898561-66-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114X3W-50mg |
| cas | 898561-66-5 |
| size | 50mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 189.20 Pln | |
| Chemat | 100mg | 304.40 Pln | |
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 1g | 918.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-(2,2-dimethylpropanoylamino)pyridine-3-carboxylic acid (CAS 898561-66-5) is a chemical compound with the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. IUPAC name: 6-(2,2-dimethylpropanoylamino)pyridine-3-carboxylic acid. InChIKey: QCCYRUYZQOXLGV-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O3 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 6-(2,2-dimethylpropanoylamino)pyridine-3-carboxylic acid |
| InChIKey | QCCYRUYZQOXLGV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=NC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)