Products 13139-27-0
CAS 13139-27-0 appears in our catalog under these names: Z-Ala-NH2, 98%, Z–ALA–NH2, Z–Ala–NH₂, Cbz-Ala-NH2 95%, Benzyl (S)-(1-amino-1-oxopropan-2-yl)carbamate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 100g, 5g, 10g.
Benzyl N-[(2S)-1-amino-1-oxopropan-2-yl]carbamate (CAS 13139-27-0) is a chemical compound with the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. IUPAC name: benzyl N-[(2S)-1-amino-1-oxopropan-2-yl]carbamate. InChIKey: CTZZSWNVVFTJRN-QMMMGPOBSA-N.
| Molecular formula | C11H14N2O3 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | benzyl N-[(2S)-1-amino-1-oxopropan-2-yl]carbamate |
| InChIKey | CTZZSWNVVFTJRN-QMMMGPOBSA-N |
| SMILES | C[C@@H](C(=O)N)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)