CAS 898561-66-5 appears in our catalog under these names: 6-(2,2-Dimethyl-propionylamino)-nicotinic acid, 95%, 6-(2,2-Dimethyl-propionylamino)-nicotinic acid, 6-(2,2-Dimethyl-propionylamino)-nicotinic acid, 95%, 95%, 6-(2,2-Dimethylpropanamido)pyridine-3-carboxylic acid, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 50mg, 5g.
6-(2,2-dimethylpropanoylamino)pyridine-3-carboxylic acid (CAS 898561-66-5) is a chemical compound with the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. IUPAC name: 6-(2,2-dimethylpropanoylamino)pyridine-3-carboxylic acid. InChIKey: QCCYRUYZQOXLGV-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O3 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 6-(2,2-dimethylpropanoylamino)pyridine-3-carboxylic acid |
| InChIKey | QCCYRUYZQOXLGV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=NC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)