cas: 1416437-27-8 — see every product listed under this CAS number, including other names
6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidine, 97%, 97% (CAS 1416437-27-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112GRH-100mg |
| cas | 1416437-27-8 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 645.20 Pln | |
| Chemat | 5g | 2128.40 Pln | |
| Chemat | 25g | 7298.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidine (CAS 1416437-27-8) is a chemical compound with the molecular formula C12H16BN3O2 and a molecular weight of 245.09 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidine. InChIKey: SPDVTVCGCCNYOC-UHFFFAOYSA-N.
| Molecular formula | C12H16BN3O2 |
|---|---|
| Molecular weight | 245.09 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidine |
| InChIKey | SPDVTVCGCCNYOC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN3C(=CC=N3)N=C2 |
Computed by PubChem (NCBI)