cas: 1004294-80-7 — see every product listed under this CAS number, including other names
6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isoindolin-1-one, 95%, 95% (CAS 1004294-80-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1112YK-100mg |
| cas | 1004294-80-7 |
| size | 100mg |
| availability | 49g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 242.00 Pln | |
| Chemat | 5g | 765.20 Pln | |
| Chemat | 10g | 1317.20 Pln | |
| Chemat | 25g | 2824.40 Pln | |
| Chemat | 500mg | 174.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroisoindol-1-one (CAS 1004294-80-7) is a chemical compound with the molecular formula C14H18BNO3 and a molecular weight of 259.11 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroisoindol-1-one. InChIKey: BUORFAFSDKNVNY-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO3 |
|---|---|
| Molecular weight | 259.11 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroisoindol-1-one |
| InChIKey | BUORFAFSDKNVNY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(CNC3=O)C=C2 |
Computed by PubChem (NCBI)