cas: 2166-13-4 — see every product listed under this CAS number, including other names
6-(4-Chlorophenyl)pyridazin-3(2H)-one 98% (CAS 2166-13-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A335315-1g |
| cas | 2166-13-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 259.12 Pln | |
| Ambeed | 25g | 698.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A335315 |
3-(4-chlorophenyl)-1H-pyridazin-6-one (CAS 2166-13-4) is a chemical compound with the molecular formula C10H7ClN2O and a molecular weight of 206.63 g/mol. IUPAC name: 3-(4-chlorophenyl)-1H-pyridazin-6-one. InChIKey: HALBJPGFCUGLFM-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O |
|---|---|
| Molecular weight | 206.63 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1H-pyridazin-6-one |
| InChIKey | HALBJPGFCUGLFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=O)C=C2)Cl |
Computed by PubChem (NCBI)