6-(Pyridin-4-yl)isoquinoline, 95%
cas: 1255860-55-9 — see every product listed under this CAS number, including other names
6-(Pyridin-4-yl)isoquinoline, 95% (CAS 1255860-55-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A802512-100mg |
| cas | 1255860-55-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 687.44 Pln | |
| Ambeed | 250mg | 1310.44 Pln | |
| Ambeed | 1g | 3401.94 Pln | |
| Ambeed | 5g | 5309.88 Pln | |
| BLDpharm | 100mg | 736.43 Pln | |
| BLDpharm | 250mg | 1402.86 Pln | |
| BLDpharm | 1g | 3663.18 Pln | |
| BLDpharm | 5g | 5718.01 Pln | |
| Fluorochem | 100mg | 700.81 Pln | |
| Fluorochem | 250mg | 1351.62 Pln | |
| Fluorochem | 1g | 3475.88 Pln | |
| Fluorochem | 5g | 5428.31 Pln | |
| Fluorochem | 10g | 10171.44 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6-pyridin-4-ylisoquinoline (CAS 1255860-55-9) is a chemical compound with the molecular formula C14H10N2 and a molecular weight of 206.24 g/mol. IUPAC name: 6-pyridin-4-ylisoquinoline. InChIKey: SOMUJVWZPGYIFI-UHFFFAOYSA-N.
| Molecular formula | C14H10N2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 6-pyridin-4-ylisoquinoline |
| InChIKey | SOMUJVWZPGYIFI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2)C=C1C3=CC=NC=C3 |
Computed by PubChem (NCBI)