cas: 791595-93-2 — see every product listed under this CAS number, including other names
6-(TRIFLUOROMETHYL)QUINOLIN-2-AMINE, 98% (CAS 791595-93-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F330736-100MG |
| cas | 791595-93-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1002.79 Pln | |
| Fluorochem | 250mg | 1565.09 Pln | |
| Fluorochem | 1g | 5318.98 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-(trifluoromethyl)quinolin-2-amine (CAS 791595-93-2) is a chemical compound with the molecular formula C10H7F3N2 and a molecular weight of 212.17 g/mol. IUPAC name: 6-(trifluoromethyl)quinolin-2-amine. InChIKey: IMXIFGHLRHXQGE-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | 6-(trifluoromethyl)quinolin-2-amine |
| InChIKey | IMXIFGHLRHXQGE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=N2)N)C=C1C(F)(F)F |
Computed by PubChem (NCBI)