cas: 2161304-72-7 — see every product listed under this CAS number, including other names
6-(Tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-amine, 97% (CAS 2161304-72-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F556612-100MG |
| cas | 2161304-72-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 794.53 Pln | |
| Fluorochem | 250mg | 1528.65 Pln | |
| Fluorochem | 1g | 3475.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-amine (CAS 2161304-72-7) is a chemical compound with the molecular formula C15H19BN2O2 and a molecular weight of 270.14 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-amine. InChIKey: FJZJAFAEGWWVHI-UHFFFAOYSA-N.
| Molecular formula | C15H19BN2O2 |
|---|---|
| Molecular weight | 270.14 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-amine |
| InChIKey | FJZJAFAEGWWVHI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)N=C(C=C3)N |
Computed by PubChem (NCBI)