cas: 834884-60-5 — see every product listed under this CAS number, including other names
6-(Thiophen-3-yl)nicotinaldehyde, 97% (CAS 834884-60-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F762750-250MG |
| cas | 834884-60-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1278.73 Pln | |
| Fluorochem | 500mg | 1908.72 Pln | |
| Fluorochem | 1g | 2840.68 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-thiophen-3-ylpyridine-3-carbaldehyde (CAS 834884-60-5) is a chemical compound with the molecular formula C10H7NOS and a molecular weight of 189.24 g/mol. IUPAC name: 6-thiophen-3-ylpyridine-3-carbaldehyde. InChIKey: FWJYLCWTCJHNRK-UHFFFAOYSA-N.
| Molecular formula | C10H7NOS |
|---|---|
| Molecular weight | 189.24 g/mol |
| IUPAC name | 6-thiophen-3-ylpyridine-3-carbaldehyde |
| InChIKey | FWJYLCWTCJHNRK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C=O)C2=CSC=C2 |
Computed by PubChem (NCBI)