cas: 162752-17-2 — see every product listed under this CAS number, including other names
6-(tert-Butyl)-2,3-dihydro-1H-inden-1-one, 97% (CAS 162752-17-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F460794-250MG |
| cas | 162752-17-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 581.06 Pln | |
| Fluorochem | 10g | 1106.92 Pln | |
| Fluorochem | 25g | 2580.36 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
6-tert-butyl-2,3-dihydroinden-1-one (CAS 162752-17-2) is a chemical compound with the molecular formula C13H16O and a molecular weight of 188.26 g/mol. IUPAC name: 6-tert-butyl-2,3-dihydroinden-1-one. InChIKey: VICFYSNYODVXCU-UHFFFAOYSA-N.
| Molecular formula | C13H16O |
|---|---|
| Molecular weight | 188.26 g/mol |
| IUPAC name | 6-tert-butyl-2,3-dihydroinden-1-one |
| InChIKey | VICFYSNYODVXCU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(CCC2=O)C=C1 |
Computed by PubChem (NCBI)