cas: 1036756-03-2 — see every product listed under this CAS number, including other names
6-AMINO-3-BROMO-2-FLUOROBENZOIC ACID, 96% (CAS 1036756-03-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F536134-1G |
| cas | 1036756-03-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 299.91 Pln | |
| Fluorochem | 10g | 544.62 Pln | |
| Fluorochem | 25g | 1028.82 Pln | |
| Fluorochem | 100g | 2851.10 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
6-amino-3-bromo-2-fluorobenzoic acid (CAS 1036756-03-2) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: 6-amino-3-bromo-2-fluorobenzoic acid. InChIKey: NUEJVMJQKLRHCO-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | 6-amino-3-bromo-2-fluorobenzoic acid |
| InChIKey | NUEJVMJQKLRHCO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)C(=O)O)F)Br |
Computed by PubChem (NCBI)