cas: 1036756-03-2 — see every product listed under this CAS number, including other names
6-Amino-3-Bromo-2-Fluorobenzoic Acid, 96%, 96% (CAS 1036756-03-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1107Z3-250mg |
| cas | 1036756-03-2 |
| size | 250mg |
| availability | 600g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 208.40 Pln | |
| Chemat | 25g | 760.40 Pln | |
| Chemat | 100g | 2445.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
6-amino-3-bromo-2-fluorobenzoic acid (CAS 1036756-03-2) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: 6-amino-3-bromo-2-fluorobenzoic acid. InChIKey: NUEJVMJQKLRHCO-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | 6-amino-3-bromo-2-fluorobenzoic acid |
| InChIKey | NUEJVMJQKLRHCO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)C(=O)O)F)Br |
Computed by PubChem (NCBI)