cas: 4460-60-0 — see every product listed under this CAS number, including other names
6-Amino-6-deoxy-D-glucopyranose, hydrochloride (CAS 4460-60-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 25mg, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM47580C-100mg |
| cas | 4460-60-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 5863.05 Pln | |
| Chemat | 250mg | 12262.56 Pln | |
| Chemat | 25mg | 2328.99 Pln | |
| Chemat | 50mg | 3653.90 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | no data |
| category | Chemicals |
6-(aminomethyl)oxane-2,3,4,5-tetrol;hydrochloride (CAS 4460-60-0) is a chemical compound with the molecular formula C6H14ClNO5 and a molecular weight of 215.63 g/mol. IUPAC name: 6-(aminomethyl)oxane-2,3,4,5-tetrol;hydrochloride. InChIKey: GHQIWWAEPCTDEU-UHFFFAOYSA-N.
| Molecular formula | C6H14ClNO5 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | 6-(aminomethyl)oxane-2,3,4,5-tetrol;hydrochloride |
| InChIKey | GHQIWWAEPCTDEU-UHFFFAOYSA-N |
| SMILES | C(C1C(C(C(C(O1)O)O)O)O)N.Cl |
Computed by PubChem (NCBI)