cas: 55324-97-5 — see every product listed under this CAS number, including other names
6-Amino-6-deoxy-D-glucose hydrochloride, ≥95%, ≥95% (CAS 55324-97-5) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148O4-5mg |
| cas | 55324-97-5 |
| size | 5mg |
| availability | 0.075g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 746.00 Pln | |
| Chemat | 10mg | 1134.80 Pln | |
| Chemat | 25mg | 2210.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(2R,3S,4R,5R)-6-amino-2,3,4,5-tetrahydroxyhexanal;hydrochloride (CAS 55324-97-5) is a chemical compound with the molecular formula C6H14ClNO5 and a molecular weight of 215.63 g/mol. IUPAC name: (2R,3S,4R,5R)-6-amino-2,3,4,5-tetrahydroxyhexanal;hydrochloride. InChIKey: QWHLASPBRRZDEV-VFQQELCFSA-N.
| Molecular formula | C6H14ClNO5 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | (2R,3S,4R,5R)-6-amino-2,3,4,5-tetrahydroxyhexanal;hydrochloride |
| InChIKey | QWHLASPBRRZDEV-VFQQELCFSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@H](C=O)O)O)O)O)N.Cl |
Computed by PubChem (NCBI)