cas: 210539-04-1 — see every product listed under this CAS number, including other names
6-Benzyl-2-chloro-5,6,7,8-tetrahydro-1,6-naphthyridine 98% (CAS 210539-04-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A265491-100mg |
| cas | 210539-04-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 214.62 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 353.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A265491 |
6-benzyl-2-chloro-7,8-dihydro-5H-1,6-naphthyridine (CAS 210539-04-1) is a chemical compound with the molecular formula C15H15ClN2 and a molecular weight of 258.74 g/mol. IUPAC name: 6-benzyl-2-chloro-7,8-dihydro-5H-1,6-naphthyridine. InChIKey: BPAUBEUYIXYWAV-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN2 |
|---|---|
| Molecular weight | 258.74 g/mol |
| IUPAC name | 6-benzyl-2-chloro-7,8-dihydro-5H-1,6-naphthyridine |
| InChIKey | BPAUBEUYIXYWAV-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1N=C(C=C2)Cl)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)