cas: 109229-22-3 — see every product listed under this CAS number, including other names
6-Benzyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4(3H)-one, 98%, 98% (CAS 109229-22-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118TEN-100mg |
| cas | 109229-22-3 |
| size | 100mg |
| availability | 2.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 88.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-benzyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (CAS 109229-22-3) is a chemical compound with the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. IUPAC name: 6-benzyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one. InChIKey: PVNGDFHKRAIVTC-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O |
|---|---|
| Molecular weight | 241.29 g/mol |
| IUPAC name | 6-benzyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| InChIKey | PVNGDFHKRAIVTC-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1N=CNC2=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)