cas: 869198-95-8 — see every product listed under this CAS number, including other names
6-Boc-2-amino-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine, 96% (CAS 869198-95-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F076827-1G |
| cas | 869198-95-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 476.93 Pln | |
| Fluorochem | 10g | 893.45 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 2-amino-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate (CAS 869198-95-8) is a chemical compound with the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. IUPAC name: tert-butyl 2-amino-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate. InChIKey: PGNLVGKPNUNOJE-UHFFFAOYSA-N.
| Molecular formula | C12H18N4O2 |
|---|---|
| Molecular weight | 250.30 g/mol |
| IUPAC name | tert-butyl 2-amino-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate |
| InChIKey | PGNLVGKPNUNOJE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=NC(=NC=C2C1)N |
Computed by PubChem (NCBI)