Products 1702260-71-6
CAS 1702260-71-6 is the registry number for Rel-4-((3S,5R)-3,5-dimethylpiperazin-1-yl)-2-nitroaniline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-2-nitroaniline (CAS 1702260-71-6) is a chemical compound with the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. IUPAC name: 4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-2-nitroaniline. InChIKey: DXSHDLTUNJKTRH-DTORHVGOSA-N.
| Molecular formula | C12H18N4O2 |
|---|---|
| Molecular weight | 250.30 g/mol |
| IUPAC name | 4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-2-nitroaniline |
| InChIKey | DXSHDLTUNJKTRH-DTORHVGOSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](N1)C)C2=CC(=C(C=C2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)