Products 2278284-21-0
CAS 2278284-21-0 is the registry number for tert-Butyl (3-(1H-1,2,3-triazol-5-yl)bicyclo[1.1.1]pentan-1-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[3-(2H-triazol-4-yl)-1-bicyclo[1.1.1]pentanyl]carbamate (CAS 2278284-21-0) is a chemical compound with the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. IUPAC name: tert-butyl N-[3-(2H-triazol-4-yl)-1-bicyclo[1.1.1]pentanyl]carbamate. InChIKey: GIAMPVNLXLSMRV-UHFFFAOYSA-N.
| Molecular formula | C12H18N4O2 |
|---|---|
| Molecular weight | 250.30 g/mol |
| IUPAC name | tert-butyl N-[3-(2H-triazol-4-yl)-1-bicyclo[1.1.1]pentanyl]carbamate |
| InChIKey | GIAMPVNLXLSMRV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC12CC(C1)(C2)C3=NNN=C3 |
Computed by PubChem (NCBI)