cas: 27452-17-1 — see every product listed under this CAS number, including other names
6-Bromo-1,1,4,4-tetramethyl-1,2,3,4-tetrahydronaphthalene, 98%, 98% (CAS 27452-17-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BD8G-250mg |
| cas | 27452-17-1 |
| size | 250mg |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 160.40 Pln | |
| Chemat | 10g | 256.40 Pln | |
| Chemat | 25g | 405.20 Pln | |
| Chemat | 50g | 650.00 Pln | |
| Chemat | 100g | 1029.20 Pln | |
| Chemat | 1kg | 2978.00 Pln | |
| Chemat | 5kg | 15235.20 Pln | |
| Chemat | 10kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-bromo-1,1,4,4-tetramethyl-2,3-dihydronaphthalene (CAS 27452-17-1) is a chemical compound with the molecular formula C14H19Br and a molecular weight of 267.20 g/mol. IUPAC name: 6-bromo-1,1,4,4-tetramethyl-2,3-dihydronaphthalene. InChIKey: NLOOVMVNNNYLFS-UHFFFAOYSA-N.
| Molecular formula | C14H19Br |
|---|---|
| Molecular weight | 267.20 g/mol |
| IUPAC name | 6-bromo-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
| InChIKey | NLOOVMVNNNYLFS-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=CC(=C2)Br)(C)C)C |
Computed by PubChem (NCBI)