CAS 27452-17-1 appears in our catalog under these names: 6-Bromo-1,1,4,4-tetramethyl-1,2,3,4-tetrahydronaphthalene, >98.0%(GC), 6-Bromo-1,1,4,4-tetramethyl-1,2,3,4-tetrahydronaphthalene, 90% , 6-Bromo-1,1,4,4-tetramethyl-1,2,3,4-tetrahydronaphthalene 97%, 6-Bromo-1,1,4,4-tetramethyl-1,2,3,4-tetrahydronaphthalene, 98%, 98%, 6-Bromo-1,1,4,4-tetramethyl-1,2,3,4-tetrahydronaphthalene. Offered by: TCI, Thermo Scientific, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg, 25g, 100g, 50g, 1kg.
6-bromo-1,1,4,4-tetramethyl-2,3-dihydronaphthalene (CAS 27452-17-1) is a chemical compound with the molecular formula C14H19Br and a molecular weight of 267.20 g/mol. IUPAC name: 6-bromo-1,1,4,4-tetramethyl-2,3-dihydronaphthalene. InChIKey: NLOOVMVNNNYLFS-UHFFFAOYSA-N.
| Molecular formula | C14H19Br |
|---|---|
| Molecular weight | 267.20 g/mol |
| IUPAC name | 6-bromo-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
| InChIKey | NLOOVMVNNNYLFS-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=CC(=C2)Br)(C)C)C |
Computed by PubChem (NCBI)