Products 1369884-44-5
CAS 1369884-44-5 is the registry number for 1-Bromo-3-(tert-butyl)-5-(cyclopropylmethyl)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-3-tert-butyl-5-(cyclopropylmethyl)benzene (CAS 1369884-44-5) is a chemical compound with the molecular formula C14H19Br and a molecular weight of 267.20 g/mol. IUPAC name: 1-bromo-3-tert-butyl-5-(cyclopropylmethyl)benzene. InChIKey: FBCVXLJNTHKNJJ-UHFFFAOYSA-N.
| Molecular formula | C14H19Br |
|---|---|
| Molecular weight | 267.20 g/mol |
| IUPAC name | 1-bromo-3-tert-butyl-5-(cyclopropylmethyl)benzene |
| InChIKey | FBCVXLJNTHKNJJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)CC2CC2)Br |
Computed by PubChem (NCBI)