6-Bromo-1-chloronaphthalene, 97%
cas: 1000391-24-1 — see every product listed under this CAS number, including other names
6-Bromo-1-chloronaphthalene, 97% (CAS 1000391-24-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A371877-100mg |
| cas | 1000391-24-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 676.31 Pln | |
| Ambeed | 5g | 2078.06 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 242.16 Pln | |
| BLDpharm | 1g | 725.32 Pln | |
| BLDpharm | 5g | 2235.90 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 294.80 Pln | |
| Chemat | 25g | 832.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
6-bromo-1-chloronaphthalene (CAS 1000391-24-1) is a chemical compound with the molecular formula C10H6BrCl and a molecular weight of 241.51 g/mol. IUPAC name: 6-bromo-1-chloronaphthalene. InChIKey: KUQJGFGVAJMCNG-UHFFFAOYSA-N.
| Molecular formula | C10H6BrCl |
|---|---|
| Molecular weight | 241.51 g/mol |
| IUPAC name | 6-bromo-1-chloronaphthalene |
| InChIKey | KUQJGFGVAJMCNG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Br)C(=C1)Cl |
Computed by PubChem (NCBI)