cas: 957121-15-2 — see every product listed under this CAS number, including other names
6-Bromo-2-chloro-3-ethoxyphenylboronic acid, ≥98%, ≥98% (CAS 957121-15-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BYO-1g |
| cas | 957121-15-2 |
| size | 1g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 856.40 Pln | |
| Chemat | 25g | 2061.20 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
(6-bromo-2-chloro-3-ethoxyphenyl)boronic acid (CAS 957121-15-2) is a chemical compound with the molecular formula C8H9BBrClO3 and a molecular weight of 279.32 g/mol. IUPAC name: (6-bromo-2-chloro-3-ethoxyphenyl)boronic acid. InChIKey: KRYOSFPUNATDPK-UHFFFAOYSA-N.
| Molecular formula | C8H9BBrClO3 |
|---|---|
| Molecular weight | 279.32 g/mol |
| IUPAC name | (6-bromo-2-chloro-3-ethoxyphenyl)boronic acid |
| InChIKey | KRYOSFPUNATDPK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Cl)OCC)Br)(O)O |
Computed by PubChem (NCBI)