CAS 1219130-51-4 is the registry number for 6-Bromo-3-methyl-3,4-dihydroisoquinolin-1(2H)-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6-bromo-3-methyl-3,4-dihydro-2H-isoquinolin-1-one (CAS 1219130-51-4) is a chemical compound with the molecular formula C10H10BrNO and a molecular weight of 240.10 g/mol. IUPAC name: 6-bromo-3-methyl-3,4-dihydro-2H-isoquinolin-1-one. InChIKey: DGUKGSUONYQZOR-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 6-bromo-3-methyl-3,4-dihydro-2H-isoquinolin-1-one |
| InChIKey | DGUKGSUONYQZOR-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C=CC(=C2)Br)C(=O)N1 |
Computed by PubChem (NCBI)