cas: 328955-61-9 — see every product listed under this CAS number, including other names
6-Bromo-4-(trifluoromethyl)quinolin-2(1H)-one, 98%, 98% (CAS 328955-61-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C7UK-250mg |
| cas | 328955-61-9 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 242.00 Pln | |
| Chemat | 10g | 419.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-bromo-4-(trifluoromethyl)-1H-quinolin-2-one (CAS 328955-61-9) is a chemical compound with the molecular formula C10H5BrF3NO and a molecular weight of 292.05 g/mol. IUPAC name: 6-bromo-4-(trifluoromethyl)-1H-quinolin-2-one. InChIKey: ADHTUPXAZQRIKI-UHFFFAOYSA-N.
| Molecular formula | C10H5BrF3NO |
|---|---|
| Molecular weight | 292.05 g/mol |
| IUPAC name | 6-bromo-4-(trifluoromethyl)-1H-quinolin-2-one |
| InChIKey | ADHTUPXAZQRIKI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CC(=O)N2)C(F)(F)F |
Computed by PubChem (NCBI)