CAS 54232-43-8 appears in our catalog under these names: 6–Bromo–5–methoxypicolinic Acid, 6-BROMO-5-METHOXY-2-PYRIDINECARBOXYLIC ACID, 98%, 98%, 6-Bromo-5-methoxypyridine-2-carboxylic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 10g, 1g, 250mg, 5g, 25g, 50g, 100g.
6-bromo-5-methoxypyridine-2-carboxylic acid (CAS 54232-43-8) is a chemical compound with the molecular formula C7H6BrNO3 and a molecular weight of 232.03 g/mol. IUPAC name: 6-bromo-5-methoxypyridine-2-carboxylic acid. InChIKey: WOXIJGVDMQJTAC-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO3 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 6-bromo-5-methoxypyridine-2-carboxylic acid |
| InChIKey | WOXIJGVDMQJTAC-UHFFFAOYSA-N |
| SMILES | COC1=C(N=C(C=C1)C(=O)O)Br |
Computed by PubChem (NCBI)