cas: 83472-62-2 — see every product listed under this CAS number, including other names
6-Bromo-7-chloro-3H-imidazo(4,5-b)pyridine, 97% (CAS 83472-62-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A795951-25g |
| cas | 83472-62-2 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 7452.34 Pln | |
| AmBeed | 10g | 4985.05 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-bromo-7-chloro-1H-imidazo[4,5-b]pyridine (CAS 83472-62-2) is a chemical compound with the molecular formula C6H3BrClN3 and a molecular weight of 232.46 g/mol. IUPAC name: 6-bromo-7-chloro-1H-imidazo[4,5-b]pyridine. InChIKey: YZFMFJGMTUIRCK-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClN3 |
|---|---|
| Molecular weight | 232.46 g/mol |
| IUPAC name | 6-bromo-7-chloro-1H-imidazo[4,5-b]pyridine |
| InChIKey | YZFMFJGMTUIRCK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C2C(=N1)N=CN2)Cl)Br |
Computed by PubChem (NCBI)