cas: 1258833-80-5 — see every product listed under this CAS number, including other names
6-Bromo-7-fluoroisoquinoline, 96% (CAS 1258833-80-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F497278-250MG |
| cas | 1258833-80-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 284.29 Pln | |
| Fluorochem | 5g | 976.76 Pln | |
| Fluorochem | 10g | 1887.89 Pln | |
| Fluorochem | 25g | 3720.58 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
6-bromo-7-fluoroisoquinoline (CAS 1258833-80-5) is a chemical compound with the molecular formula C9H5BrFN and a molecular weight of 226.04 g/mol. IUPAC name: 6-bromo-7-fluoroisoquinoline. InChIKey: SEHPXAKLMRODLS-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFN |
|---|---|
| Molecular weight | 226.04 g/mol |
| IUPAC name | 6-bromo-7-fluoroisoquinoline |
| InChIKey | SEHPXAKLMRODLS-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=CC(=C(C=C21)Br)F |
Computed by PubChem (NCBI)