CAS 1416439-00-3 appears in our catalog under these names: 3–Bromo–5–fluoroquinoline, 3-Bromo-5-fluoroquinoline, 95%, 3-Bromo-5-fluoroquinoline, 98+%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-bromo-5-fluoroquinoline (CAS 1416439-00-3) is a chemical compound with the molecular formula C9H5BrFN and a molecular weight of 226.04 g/mol. IUPAC name: 3-bromo-5-fluoroquinoline. InChIKey: MPVCOZUPDLYPQM-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFN |
|---|---|
| Molecular weight | 226.04 g/mol |
| IUPAC name | 3-bromo-5-fluoroquinoline |
| InChIKey | MPVCOZUPDLYPQM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=N2)Br)C(=C1)F |
Computed by PubChem (NCBI)