CAS 1841081-73-9 appears in our catalog under these names: 5-Bromo-4-fluoroisoquinoline, 95%, 5-Bromo-4-fluoroisoquinoline, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
5-bromo-4-fluoroisoquinoline (CAS 1841081-73-9) is a chemical compound with the molecular formula C9H5BrFN and a molecular weight of 226.04 g/mol. IUPAC name: 5-bromo-4-fluoroisoquinoline. InChIKey: WQUYQODCVVFRMV-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFN |
|---|---|
| Molecular weight | 226.04 g/mol |
| IUPAC name | 5-bromo-4-fluoroisoquinoline |
| InChIKey | WQUYQODCVVFRMV-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=CC(=C2C(=C1)Br)F |
Computed by PubChem (NCBI)