CAS 68847-94-9 is the registry number for 3-Bromo-4H-thiochromen-4-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromothiochromen-4-one (CAS 68847-94-9) is a chemical compound with the molecular formula C9H5BrOS and a molecular weight of 241.11 g/mol. IUPAC name: 3-bromothiochromen-4-one. InChIKey: HNGUKFYOSVSQJM-UHFFFAOYSA-N.
| Molecular formula | C9H5BrOS |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | 3-bromothiochromen-4-one |
| InChIKey | HNGUKFYOSVSQJM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=CS2)Br |
Computed by PubChem (NCBI)