CAS 19075-43-5 appears in our catalog under these names: 4-Bromo-1-benzothiophene-2-carbaldehyde, 95%, 4–Bromobenzo(b)thiophene–2–carbaldehyde, 4-Bromobenzo(b)thiophene-2-carboxaldehyde. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 2,5g.
4-bromo-1-benzothiophene-2-carbaldehyde (CAS 19075-43-5) is a chemical compound with the molecular formula C9H5BrOS and a molecular weight of 241.11 g/mol. IUPAC name: 4-bromo-1-benzothiophene-2-carbaldehyde. InChIKey: AISRITCYHXZEOO-UHFFFAOYSA-N.
| Molecular formula | C9H5BrOS |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | 4-bromo-1-benzothiophene-2-carbaldehyde |
| InChIKey | AISRITCYHXZEOO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(S2)C=O)C(=C1)Br |
Computed by PubChem (NCBI)