6-Bromobenzo[d][1,3]dioxol-5-ol, 95%
cas: 6941-70-4 — see every product listed under this CAS number, including other names
6-Bromobenzo[d][1,3]dioxol-5-ol, 95% (CAS 6941-70-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A244201-100mg |
| cas | 6941-70-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 776.44 Pln | |
| Ambeed | 5g | 2200.44 Pln | |
| Ambeed | 10g | 3630.00 Pln | |
| BLDpharm | 100mg | 281.04 Pln | |
| BLDpharm | 250mg | 364.34 Pln | |
| BLDpharm | 1g | 830.84 Pln | |
| BLDpharm | 5g | 2369.19 Pln | |
| BLDpharm | 10g | 3907.54 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
6-bromo-1,3-benzodioxol-5-ol (CAS 6941-70-4) is a chemical compound with the molecular formula C7H5BrO3 and a molecular weight of 217.02 g/mol. IUPAC name: 6-bromo-1,3-benzodioxol-5-ol. InChIKey: TUYBCLHMZFLWRY-UHFFFAOYSA-N.
| Molecular formula | C7H5BrO3 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 6-bromo-1,3-benzodioxol-5-ol |
| InChIKey | TUYBCLHMZFLWRY-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)O)Br |
Computed by PubChem (NCBI)
