cas: 71590-31-3 — see every product listed under this CAS number, including other names
6-Bromonaphthalen-2-amine hydrochloride 97% (CAS 71590-31-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A116670-5g |
| cas | 71590-31-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 242.44 Pln | |
| Ambeed | 10g | 392.62 Pln | |
| Ambeed | 25g | 631.81 Pln | |
| Ambeed | 100g | 2306.13 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A116670 |
6-bromonaphthalen-2-amine;hydrochloride (CAS 71590-31-3) is a chemical compound with the molecular formula C10H9BrClN and a molecular weight of 258.54 g/mol. IUPAC name: 6-bromonaphthalen-2-amine;hydrochloride. InChIKey: PIUVTVGJKFGBJL-UHFFFAOYSA-N.
| Molecular formula | C10H9BrClN |
|---|---|
| Molecular weight | 258.54 g/mol |
| IUPAC name | 6-bromonaphthalen-2-amine;hydrochloride |
| InChIKey | PIUVTVGJKFGBJL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Br)C=C1N.Cl |
Computed by PubChem (NCBI)